C29H25ClN4O6 — CID 171610982
3-[6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-4-oxochromen-8-yl]ethoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 171610982) has the molecular formula C29H25ClN4O6 and a molecular weight of 560.99 g/mol. Its IUPAC name is 3-[6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-4-oxochromen-8-yl]ethoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-4-oxochromen-8-yl]ethoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 171610982 |
| Molecular Formula | C29H25ClN4O6 |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 3-[6-chloro-3-[(1R)-1-[3,6-dimethyl-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-4-oxochromen-8-yl]ethoxy]-2-pyridinyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2-c2noc(=O)[nH]2)c2oc(-c3ccc4c(c3)OCCN4C)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C29H25ClN4O6/c1-14-11-18(16(3)38-21-7-8-23(30)31-24(21)28-32-29(36)40-33-28)27-19(12-14)25(35)15(2)26(39-27)17-5-6-20-22(13-17)37-10-9-34(20)4/h5-8,11-13,16H,9-10H2,1-4H3,(H,32,33,36)/t16-/m1/s1 |
| InChIKey | PLTRMQOCONTWES-MRXNPFEDSA-N |
| XLogP | 5.44 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|