C21H16Cl3FN2O3 — CID 171612315
2-chloro-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-5-(3-methoxyphenoxy)pyridine-4-carboxamide (PubChem CID 171612315) has the molecular formula C21H16Cl3FN2O3 and a molecular weight of 469.73 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-5-(3-methoxyphenoxy)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-5-(3-methoxyphenoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171612315 |
| Molecular Formula | C21H16Cl3FN2O3 |
| Molecular Weight | 469.73 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-5-(3-methoxyphenoxy)pyridine-4-carboxamide |
| SMILES | COc1cccc(Oc2cnc(Cl)cc2C(=O)NCC(F)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H16Cl3FN2O3/c1-29-13-3-2-4-14(8-13)30-19-11-26-20(24)9-16(19)21(28)27-10-18(25)15-6-5-12(22)7-17(15)23/h2-9,11,18H,10H2,1H3,(H,27,28) |
| InChIKey | ORDACVIHYJUHGT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|