C23H20ClF3N2O2 — CID 157036898
2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]-5-[3-(trifluoromethyl)phenoxy]pyridine-4-carboxamide (PubChem CID 157036898) has the molecular formula C23H20ClF3N2O2 and a molecular weight of 448.87 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]-5-[3-(trifluoromethyl)phenoxy]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]-5-[3-(trifluoromethyl)phenoxy]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 157036898 |
| Molecular Formula | C23H20ClF3N2O2 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dimethylphenyl)ethyl]-5-[3-(trifluoromethyl)phenoxy]pyridine-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2cc(Cl)ncc2Oc2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C23H20ClF3N2O2/c1-14-6-7-16(15(2)10-14)8-9-28-22(30)19-12-21(24)29-13-20(19)31-18-5-3-4-17(11-18)23(25,26)27/h3-7,10-13H,8-9H2,1-2H3,(H,28,30) |
| InChIKey | ZJNVREJUPGUPPW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|