C23H21Cl2FN2O2 — CID 157036920
2-chloro-5-(3-chloro-2-fluorophenoxy)-N-[2-(2,4-dimethylphenyl)ethyl]-3-methylpyridine-4-carboxamide (PubChem CID 157036920) has the molecular formula C23H21Cl2FN2O2 and a molecular weight of 447.34 g/mol. Its IUPAC name is 2-chloro-5-(3-chloro-2-fluorophenoxy)-N-[2-(2,4-dimethylphenyl)ethyl]-3-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-5-(3-chloro-2-fluorophenoxy)-N-[2-(2,4-dimethylphenyl)ethyl]-3-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 157036920 |
| Molecular Formula | C23H21Cl2FN2O2 |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-chloro-5-(3-chloro-2-fluorophenoxy)-N-[2-(2,4-dimethylphenyl)ethyl]-3-methylpyridine-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2c(Oc3cccc(Cl)c3F)cnc(Cl)c2C)c(C)c1 |
| InChI | InChI=1S/C23H21Cl2FN2O2/c1-13-7-8-16(14(2)11-13)9-10-27-23(29)20-15(3)22(25)28-12-19(20)30-18-6-4-5-17(24)21(18)26/h4-8,11-12H,9-10H2,1-3H3,(H,27,29) |
| InChIKey | VCJITUSIYCOCOX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|