C23H22ClFN4O3S — CID 171832385
methyl N-[[3-(3-chloro-2-fluorophenoxy)-6-methylpyridazine-4-carbothioyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate (PubChem CID 171832385) has the molecular formula C23H22ClFN4O3S and a molecular weight of 488.97 g/mol. Its IUPAC name is methyl N-[[3-(3-chloro-2-fluorophenoxy)-6-methylpyridazine-4-carbothioyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate.
| Compound Name | methyl N-[[3-(3-chloro-2-fluorophenoxy)-6-methylpyridazine-4-carbothioyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 171832385 |
| Molecular Formula | C23H22ClFN4O3S |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | methyl N-[[3-(3-chloro-2-fluorophenoxy)-6-methylpyridazine-4-carbothioyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate |
| SMILES | COC(=O)N(Cc1ccc(C)cc1C)NC(=S)c1cc(C)nnc1Oc1cccc(Cl)c1F |
| InChI | InChI=1S/C23H22ClFN4O3S/c1-13-8-9-16(14(2)10-13)12-29(23(30)31-4)28-22(33)17-11-15(3)26-27-21(17)32-19-7-5-6-18(24)20(19)25/h5-11H,12H2,1-4H3,(H,28,33) |
| InChIKey | AEIHMZVZVCKQII-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|