C25H25FN4O4 — CID 171832420
methyl N-[[5-(3-cyclopropyl-2-fluorophenoxy)pyridazine-4-carbonyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate (PubChem CID 171832420) has the molecular formula C25H25FN4O4 and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl N-[[5-(3-cyclopropyl-2-fluorophenoxy)pyridazine-4-carbonyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate.
| Compound Name | methyl N-[[5-(3-cyclopropyl-2-fluorophenoxy)pyridazine-4-carbonyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 171832420 |
| Molecular Formula | C25H25FN4O4 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | methyl N-[[5-(3-cyclopropyl-2-fluorophenoxy)pyridazine-4-carbonyl]amino]-N-[(2,4-dimethylphenyl)methyl]carbamate |
| SMILES | COC(=O)N(Cc1ccc(C)cc1C)NC(=O)c1cnncc1Oc1cccc(C2CC2)c1F |
| InChI | InChI=1S/C25H25FN4O4/c1-15-7-8-18(16(2)11-15)14-30(25(32)33-3)29-24(31)20-12-27-28-13-22(20)34-21-6-4-5-19(23(21)26)17-9-10-17/h4-8,11-13,17H,9-10,14H2,1-3H3,(H,29,31) |
| InChIKey | ULIPSOXFFGLZBW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|