C29H26Cl2FN3O2 — CID 168854911
N'-[(2R)-1-chloro-3-(2-chloro-4-methylphenyl)propan-2-yl]-3-(3-cyclopropyl-2-fluorophenoxy)-N-hydroxyquinoline-4-carboximidamide (PubChem CID 168854911) has the molecular formula C29H26Cl2FN3O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is N'-[(2R)-1-chloro-3-(2-chloro-4-methylphenyl)propan-2-yl]-3-(3-cyclopropyl-2-fluorophenoxy)-N-hydroxyquinoline-4-carboximidamide.
| Compound Name | N'-[(2R)-1-chloro-3-(2-chloro-4-methylphenyl)propan-2-yl]-3-(3-cyclopropyl-2-fluorophenoxy)-N-hydroxyquinoline-4-carboximidamide |
|---|---|
| PubChem CID | 168854911 |
| Molecular Formula | C29H26Cl2FN3O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N'-[(2R)-1-chloro-3-(2-chloro-4-methylphenyl)propan-2-yl]-3-(3-cyclopropyl-2-fluorophenoxy)-N-hydroxyquinoline-4-carboximidamide |
| SMILES | Cc1ccc(C[C@H](CCl)/N=C(\NO)c2c(Oc3cccc(C4CC4)c3F)cnc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C29H26Cl2FN3O2/c1-17-9-10-19(23(31)13-17)14-20(15-30)34-29(35-36)27-22-5-2-3-7-24(22)33-16-26(27)37-25-8-4-6-21(28(25)32)18-11-12-18/h2-10,13,16,18,20,36H,11-12,14-15H2,1H3,(H,34,35)/t20-/m1/s1 |
| InChIKey | OQWZHAUNYAZIHE-HXUWFJFHSA-N |
| XLogP | 7.58 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|