C17H20BrClN4O — CID 169041139
5-bromo-N'-[(2R)-1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-N-hydroxy-2-methylpyrimidine-4-carboximidamide (PubChem CID 169041139) has the molecular formula C17H20BrClN4O and a molecular weight of 411.73 g/mol. Its IUPAC name is 5-bromo-N'-[(2R)-1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-N-hydroxy-2-methylpyrimidine-4-carboximidamide.
| Compound Name | 5-bromo-N'-[(2R)-1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-N-hydroxy-2-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 169041139 |
| Molecular Formula | C17H20BrClN4O |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 5-bromo-N'-[(2R)-1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-N-hydroxy-2-methylpyrimidine-4-carboximidamide |
| SMILES | Cc1ccc(C[C@H](CCl)/N=C(\NO)c2nc(C)ncc2Br)c(C)c1 |
| InChI | InChI=1S/C17H20BrClN4O/c1-10-4-5-13(11(2)6-10)7-14(8-19)22-17(23-24)16-15(18)9-20-12(3)21-16/h4-6,9,14,24H,7-8H2,1-3H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | NJLUEAWAYFEIGI-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|