C17H20BrClN4 — CID 168863112
5-bromo-N'-[1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-2-methylpyrimidine-4-carboximidamide (PubChem CID 168863112) has the molecular formula C17H20BrClN4 and a molecular weight of 395.73 g/mol. Its IUPAC name is 5-bromo-N'-[1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-2-methylpyrimidine-4-carboximidamide.
| Compound Name | 5-bromo-N'-[1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-2-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 168863112 |
| Molecular Formula | C17H20BrClN4 |
| Molecular Weight | 395.73 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 5-bromo-N'-[1-chloro-3-(2,4-dimethylphenyl)propan-2-yl]-2-methylpyrimidine-4-carboximidamide |
| SMILES | Cc1ccc(CC(CCl)/N=C(\N)c2nc(C)ncc2Br)c(C)c1 |
| InChI | InChI=1S/C17H20BrClN4/c1-10-4-5-13(11(2)6-10)7-14(8-19)23-17(20)16-15(18)9-21-12(3)22-16/h4-6,9,14H,7-8H2,1-3H3,(H2,20,23) |
| InChIKey | LSRDMNHKSKPSRO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|