C17H21BrN4O2S — CID 162376752
N-[(2R)-1-aminooxy-3-(2,4-dimethylphenyl)propan-2-yl]-5-bromo-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 162376752) has the molecular formula C17H21BrN4O2S and a molecular weight of 425.35 g/mol. Its IUPAC name is N-[(2R)-1-aminooxy-3-(2,4-dimethylphenyl)propan-2-yl]-5-bromo-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | N-[(2R)-1-aminooxy-3-(2,4-dimethylphenyl)propan-2-yl]-5-bromo-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 162376752 |
| Molecular Formula | C17H21BrN4O2S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[(2R)-1-aminooxy-3-(2,4-dimethylphenyl)propan-2-yl]-5-bromo-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Br)c(C(=O)N[C@@H](CON)Cc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C17H21BrN4O2S/c1-10-4-5-12(11(2)6-10)7-13(9-24-19)21-16(23)15-14(18)8-20-17(22-15)25-3/h4-6,8,13H,7,9,19H2,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | DBNOWZUVYRXVNH-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|