About butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate
butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate (PubChem CID 123187615) has the molecular formula C10H13BrN2O2S
and a molecular weight of 305.20 g/mol. Its IUPAC name is butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate |
| PubChem CID | 123187615 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate |
| SMILES | CCC(C)OC(=O)c1nc(SC)ncc1Br |
| InChI | InChI=1S/C10H13BrN2O2S/c1-4-6(2)15-9(14)8-7(11)5-12-10(13-8)16-3/h5-6H,4H2,1-3H3 |
| InChIKey | OKUCWOKXWXTIFO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate?
The IUPAC name of butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate (CID 123187615) is butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate.
What is the SMILES notation for butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate?
The canonical SMILES for butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate is CCC(C)OC(=O)c1nc(SC)ncc1Br.
What is the InChIKey of butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate?
The InChIKey is OKUCWOKXWXTIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2S/c1-4-6(2)15-9(14)8-7(11)5-12-10(13-8)16-3/h5-6H,4H2,1-3H3.
What are the key properties of butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate?
butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate has a molecular weight of 305.20 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate is sourced from PubChem (CID 123187615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).