C10H13N3O2 — CID 171612406
2-methoxy-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carbonitrile (PubChem CID 171612406) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-methoxy-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carbonitrile.
| Compound Name | 2-methoxy-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 171612406 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-methoxy-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carbonitrile |
| SMILES | COc1nc(C)c(C#N)n1C[C@@H]1CCO1 |
| InChI | InChI=1S/C10H13N3O2/c1-7-9(5-11)13(10(12-7)14-2)6-8-3-4-15-8/h8H,3-4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | CNTAIRXAFOGLCR-QMMMGPOBSA-N |
| XLogP | 0.86 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |