C39H36N8O6 — CID 171612559
2-(2,6-dioxopiperidin-3-yl)-5-[[3-[4-[2-[4-[[2-(1,2,4-triazol-4-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]amino]isoindole-1,3-dione (PubChem CID 171612559) has the molecular formula C39H36N8O6 and a molecular weight of 712.77 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[3-[4-[2-[4-[[2-(1,2,4-triazol-4-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[3-[4-[2-[4-[[2-(1,2,4-triazol-4-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171612559 |
| Molecular Formula | C39H36N8O6 |
| Molecular Weight | 712.77 g/mol |
| Exact Mass | 712.28 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[3-[4-[2-[4-[[2-(1,2,4-triazol-4-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]amino]isoindole-1,3-dione |
| SMILES | CC(C)(c1ccc(OCc2ccnc(-n3cnnc3)n2)cc1)c1ccc(OC2CC(Nc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)cc1 |
| InChI | InChI=1S/C39H36N8O6/c1-39(2,23-3-8-28(9-4-23)52-20-26-15-16-40-38(44-26)46-21-41-42-22-46)24-5-10-29(11-6-24)53-30-17-27(18-30)43-25-7-12-31-32(19-25)37(51)47(36(31)50)33-13-14-34(48)45-35(33)49/h3-12,15-16,19,21-22,27,30,33,43H,13-14,17-18,20H2,1-2H3,(H,45,48,49) |
| InChIKey | JCDHQNCWFBKBFZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|