C38H35N5O7 — CID 167437153
2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-([1,3]oxazolo[4,5-b]pyridin-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione (PubChem CID 167437153) has the molecular formula C38H35N5O7 and a molecular weight of 673.73 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-([1,3]oxazolo[4,5-b]pyridin-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-([1,3]oxazolo[4,5-b]pyridin-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167437153 |
| Molecular Formula | C38H35N5O7 |
| Molecular Weight | 673.73 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-([1,3]oxazolo[4,5-b]pyridin-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione |
| SMILES | CC(C)(c1ccc(OCCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccc(OCc2nc3ncccc3o2)cc1 |
| InChI | InChI=1S/C38H35N5O7/c1-38(2,24-8-13-27(14-9-24)49-22-33-42-34-31(50-33)5-3-18-40-34)23-6-11-26(12-7-23)48-20-4-19-39-25-10-15-28-29(21-25)37(47)43(36(28)46)30-16-17-32(44)41-35(30)45/h3,5-15,18,21,30,39H,4,16-17,19-20,22H2,1-2H3,(H,41,44,45) |
| InChIKey | NSJBLILGJXDXRT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 152.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|