C37H41ClN4O8 — CID 175567886
2-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl]acetamide (PubChem CID 175567886) has the molecular formula C37H41ClN4O8 and a molecular weight of 705.21 g/mol. Its IUPAC name is 2-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl]acetamide.
| Compound Name | 2-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl]acetamide |
|---|---|
| PubChem CID | 175567886 |
| Molecular Formula | C37H41ClN4O8 |
| Molecular Weight | 705.21 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 2-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl]acetamide |
| SMILES | CC(C)(c1ccc(OCC(=O)NCCCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccc(OCC(O)CCl)cc1 |
| InChI | InChI=1S/C37H41ClN4O8/c1-37(2,23-5-10-27(11-6-23)49-21-26(43)20-38)24-7-12-28(13-8-24)50-22-33(45)40-18-4-3-17-39-25-9-14-29-30(19-25)36(48)42(35(29)47)31-15-16-32(44)41-34(31)46/h5-14,19,26,31,39,43H,3-4,15-18,20-22H2,1-2H3,(H,40,45)(H,41,44,46) |
| InChIKey | PFNWMTYHLVQIMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|