C20H41NO6SSi — CID 171613128
tert-butyl (3R)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxypropyl]piperidine-1-carboxylate (PubChem CID 171613128) has the molecular formula C20H41NO6SSi and a molecular weight of 451.70 g/mol. Its IUPAC name is tert-butyl (3R)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171613128 |
| Molecular Formula | C20H41NO6SSi |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | tert-butyl (3R)-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxypropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(CCOS(C)(=O)=O)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H41NO6SSi/c1-19(2,3)26-18(22)21-13-10-11-16(15-21)17(12-14-25-28(7,23)24)27-29(8,9)20(4,5)6/h16-17H,10-15H2,1-9H3/t16-,17?/m1/s1 |
| InChIKey | OGZVCIGNMHIBQS-TZHYSIJRSA-N |
| XLogP | 4.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|