C21H22ClN5 — CID 171614209
N-chloro-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[2-(1-methylpyrazol-4-yl)ethynyl]pyridin-4-amine (PubChem CID 171614209) has the molecular formula C21H22ClN5 and a molecular weight of 379.90 g/mol. Its IUPAC name is N-chloro-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[2-(1-methylpyrazol-4-yl)ethynyl]pyridin-4-amine.
| Compound Name | N-chloro-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[2-(1-methylpyrazol-4-yl)ethynyl]pyridin-4-amine |
|---|---|
| PubChem CID | 171614209 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-chloro-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[2-(1-methylpyrazol-4-yl)ethynyl]pyridin-4-amine |
| SMILES | CN(C)Cc1ccc(CN(Cl)c2ccncc2C#Cc2cnn(C)c2)cc1 |
| InChI | InChI=1S/C21H22ClN5/c1-25(2)14-17-4-6-18(7-5-17)16-27(22)21-10-11-23-13-20(21)9-8-19-12-24-26(3)15-19/h4-7,10-13,15H,14,16H2,1-3H3 |
| InChIKey | HXBBQDJFIHOUOV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|