C18H21BrN2O3S — CID 171614509
ethyl 4-[[2-(5-bromo-1H-indol-3-yl)acetyl]amino]thiane-4-carboxylate (PubChem CID 171614509) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is ethyl 4-[[2-(5-bromo-1H-indol-3-yl)acetyl]amino]thiane-4-carboxylate.
| Compound Name | ethyl 4-[[2-(5-bromo-1H-indol-3-yl)acetyl]amino]thiane-4-carboxylate |
|---|---|
| PubChem CID | 171614509 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | ethyl 4-[[2-(5-bromo-1H-indol-3-yl)acetyl]amino]thiane-4-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)Cc2c[nH]c3ccc(Br)cc23)CCSCC1 |
| InChI | InChI=1S/C18H21BrN2O3S/c1-2-24-17(23)18(5-7-25-8-6-18)21-16(22)9-12-11-20-15-4-3-13(19)10-14(12)15/h3-4,10-11,20H,2,5-9H2,1H3,(H,21,22) |
| InChIKey | MVIJIDHRLUQQQN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |