C10H19NO3S — CID 171615973
3-ethyl-1-propyl-1H-pyrrol-1-ium;methanesulfonate (PubChem CID 171615973) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 3-ethyl-1-propyl-1H-pyrrol-1-ium;methanesulfonate.
| Compound Name | 3-ethyl-1-propyl-1H-pyrrol-1-ium;methanesulfonate |
|---|---|
| PubChem CID | 171615973 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-ethyl-1-propyl-1H-pyrrol-1-ium;methanesulfonate |
| SMILES | CCC[NH+]1C=CC(CC)=C1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H15N.CH4O3S/c1-3-6-10-7-5-9(4-2)8-10;1-5(2,3)4/h5,7-8H,3-4,6H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | VCCLOESYHRBKQT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|