C12H21NO2 — CID 171616059
1,3-dipropyl-1H-pyrrol-1-ium acetate (PubChem CID 171616059) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1,3-dipropyl-1H-pyrrol-1-ium acetate.
| Compound Name | 1,3-dipropyl-1H-pyrrol-1-ium acetate |
|---|---|
| PubChem CID | 171616059 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1,3-dipropyl-1H-pyrrol-1-ium acetate |
| SMILES | CC(=O)[O-].CCCC1=C[NH+](CCC)C=C1 |
| InChI | InChI=1S/C10H17N.C2H4O2/c1-3-5-10-6-8-11(9-10)7-4-2;1-2(3)4/h6,8-9H,3-5,7H2,1-2H3;1H3,(H,3,4) |
| InChIKey | RWOUXVOIFWLYOO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |