C14H14FNO2S — CID 171617949
tert-butyl 4-fluoro-2-(1,3-thiazol-2-yl)benzoate (PubChem CID 171617949) has the molecular formula C14H14FNO2S and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl 4-fluoro-2-(1,3-thiazol-2-yl)benzoate.
| Compound Name | tert-butyl 4-fluoro-2-(1,3-thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 171617949 |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | tert-butyl 4-fluoro-2-(1,3-thiazol-2-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(F)cc1-c1nccs1 |
| InChI | InChI=1S/C14H14FNO2S/c1-14(2,3)18-13(17)10-5-4-9(15)8-11(10)12-16-6-7-19-12/h4-8H,1-3H3 |
| InChIKey | LOMTUYGJHFQJNW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |