C18H18F2N2O — CID 171619599
(2R,3S)-5-(5,6-dimethyl-3-pyridinyl)-8,9-difluoro-2,3-dimethyl-2,3-dihydro-1,4-benzoxazepine (PubChem CID 171619599) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is (2R,3S)-5-(5,6-dimethyl-3-pyridinyl)-8,9-difluoro-2,3-dimethyl-2,3-dihydro-1,4-benzoxazepine.
| Compound Name | (2R,3S)-5-(5,6-dimethyl-3-pyridinyl)-8,9-difluoro-2,3-dimethyl-2,3-dihydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 171619599 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2R,3S)-5-(5,6-dimethyl-3-pyridinyl)-8,9-difluoro-2,3-dimethyl-2,3-dihydro-1,4-benzoxazepine |
| SMILES | Cc1cc(C2=N[C@@H](C)[C@@H](C)Oc3c2ccc(F)c3F)cnc1C |
| InChI | InChI=1S/C18H18F2N2O/c1-9-7-13(8-21-10(9)2)17-14-5-6-15(19)16(20)18(14)23-12(4)11(3)22-17/h5-8,11-12H,1-4H3/t11-,12+/m0/s1 |
| InChIKey | YUEPUNIMCRFJTK-NWDGAFQWSA-N |
| XLogP | 3.98 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |