C20H13ClFN3O — CID 171620910
6-(5-chloro-2-fluorophenyl)-4-(quinolin-4-ylamino)pyridin-3-ol (PubChem CID 171620910) has the molecular formula C20H13ClFN3O and a molecular weight of 365.80 g/mol. Its IUPAC name is 6-(5-chloro-2-fluorophenyl)-4-(quinolin-4-ylamino)pyridin-3-ol.
| Compound Name | 6-(5-chloro-2-fluorophenyl)-4-(quinolin-4-ylamino)pyridin-3-ol |
|---|---|
| PubChem CID | 171620910 |
| Molecular Formula | C20H13ClFN3O |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 6-(5-chloro-2-fluorophenyl)-4-(quinolin-4-ylamino)pyridin-3-ol |
| SMILES | Oc1cnc(-c2cc(Cl)ccc2F)cc1Nc1ccnc2ccccc12 |
| InChI | InChI=1S/C20H13ClFN3O/c21-12-5-6-15(22)14(9-12)18-10-19(20(26)11-24-18)25-17-7-8-23-16-4-2-1-3-13(16)17/h1-11,26H,(H,23,24,25) |
| InChIKey | UAFRDNHHLPQBOU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |