C13H17IN2O3S — CID 17162139
N-(1-hydroxybutan-2-ylcarbamothioyl)-3-iodo-4-methoxybenzamide (PubChem CID 17162139) has the molecular formula C13H17IN2O3S and a molecular weight of 408.26 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-ylcarbamothioyl)-3-iodo-4-methoxybenzamide.
| Compound Name | N-(1-hydroxybutan-2-ylcarbamothioyl)-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 17162139 |
| Molecular Formula | C13H17IN2O3S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | N-(1-hydroxybutan-2-ylcarbamothioyl)-3-iodo-4-methoxybenzamide |
| SMILES | CCC(CO)NC(=S)NC(=O)c1ccc(OC)c(I)c1 |
| InChI | InChI=1S/C13H17IN2O3S/c1-3-9(7-17)15-13(20)16-12(18)8-4-5-11(19-2)10(14)6-8/h4-6,9,17H,3,7H2,1-2H3,(H2,15,16,18,20) |
| InChIKey | AWJWUQUBOOXCHI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|