C15H22N2O3S — CID 17162169
N-(1-hydroxybutan-2-ylcarbamothioyl)-4-propan-2-yloxybenzamide (PubChem CID 17162169) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-ylcarbamothioyl)-4-propan-2-yloxybenzamide.
| Compound Name | N-(1-hydroxybutan-2-ylcarbamothioyl)-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17162169 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(1-hydroxybutan-2-ylcarbamothioyl)-4-propan-2-yloxybenzamide |
| SMILES | CCC(CO)NC(=S)NC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-4-12(9-18)16-15(21)17-14(19)11-5-7-13(8-6-11)20-10(2)3/h5-8,10,12,18H,4,9H2,1-3H3,(H2,16,17,19,21) |
| InChIKey | ALCCUEMCAPKKFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|