C19H30N2O3S — CID 17162168
4-heptoxy-N-(1-hydroxybutan-2-ylcarbamothioyl)benzamide (PubChem CID 17162168) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-heptoxy-N-(1-hydroxybutan-2-ylcarbamothioyl)benzamide.
| Compound Name | 4-heptoxy-N-(1-hydroxybutan-2-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 17162168 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 4-heptoxy-N-(1-hydroxybutan-2-ylcarbamothioyl)benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)NC(CC)CO)cc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-3-5-6-7-8-13-24-17-11-9-15(10-12-17)18(23)21-19(25)20-16(4-2)14-22/h9-12,16,22H,3-8,13-14H2,1-2H3,(H2,20,21,23,25) |
| InChIKey | VKSNOQKOIOSNGX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|