C27H33N7O2 — CID 171622754
4-[(4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622754) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 4-[(4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-[(4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622754 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 4-[(4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1c(Nc2cc[nH]c(=O)c2C(=O)Nc2ccc(N3CCN(C)CC3)cc2)cnc2c1NCCC2C |
| InChI | InChI=1S/C27H33N7O2/c1-17-8-10-28-25-18(2)22(16-30-24(17)25)32-21-9-11-29-26(35)23(21)27(36)31-19-4-6-20(7-5-19)34-14-12-33(3)13-15-34/h4-7,9,11,16-17,28H,8,10,12-15H2,1-3H3,(H,31,36)(H2,29,32,35) |
| InChIKey | QLMCTDPZNQNKHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|