C27H31N7O4 — CID 177267413
N-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)phenyl]-4-[(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)amino]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 177267413) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is N-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)phenyl]-4-[(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)amino]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)phenyl]-4-[(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177267413 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[4-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)phenyl]-4-[(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1c(Nc2cc[nH]c(=O)c2C(=O)Nc2ccc(N3CCN4CCOCC4C3)cc2)cnc2c1NCCO2 |
| InChI | InChI=1S/C27H31N7O4/c1-17-22(14-30-27-24(17)28-8-12-38-27)32-21-6-7-29-25(35)23(21)26(36)31-18-2-4-19(5-3-18)34-10-9-33-11-13-37-16-20(33)15-34/h2-7,14,20,28H,8-13,15-16H2,1H3,(H,31,36)(H2,29,32,35) |
| InChIKey | CWCLWYYIYBPGQV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|