C17H24N2 — CID 171623104
N-ethyl-N-methyl-5-(3-methylphenyl)spiro[2.3]hexane-5-carboximidamide (PubChem CID 171623104) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-ethyl-N-methyl-5-(3-methylphenyl)spiro[2.3]hexane-5-carboximidamide.
| Compound Name | N-ethyl-N-methyl-5-(3-methylphenyl)spiro[2.3]hexane-5-carboximidamide |
|---|---|
| PubChem CID | 171623104 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-ethyl-N-methyl-5-(3-methylphenyl)spiro[2.3]hexane-5-carboximidamide |
| SMILES | [H]/N=C(\N(C)CC)C1(c2cccc(C)c2)CC2(CC2)C1 |
| InChI | InChI=1S/C17H24N2/c1-4-19(3)15(18)17(11-16(12-17)8-9-16)14-7-5-6-13(2)10-14/h5-7,10,18H,4,8-9,11-12H2,1-3H3/b18-15- |
| InChIKey | CNOJVXYUGRSINF-SDXDJHTJSA-N |
| XLogP | 3.74 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|