C14H20N2 — CID 63179364
N,N-dimethyl-1-phenylcyclopentane-1-carboximidamide (PubChem CID 63179364) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylcyclopentane-1-carboximidamide.
| Compound Name | N,N-dimethyl-1-phenylcyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 63179364 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N,N-dimethyl-1-phenylcyclopentane-1-carboximidamide |
| SMILES | [H]/N=C(\N(C)C)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C14H20N2/c1-16(2)13(15)14(10-6-7-11-14)12-8-4-3-5-9-12/h3-5,8-9,15H,6-7,10-11H2,1-2H3/b15-13- |
| InChIKey | YWAMWXOWTZUQSC-SQFISAMPSA-N |
| XLogP | 3.04 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|