About [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate
[3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate (PubChem CID 17162315) has the molecular formula C24H21BrO5
and a molecular weight of 469.33 g/mol. Its IUPAC name is [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate.
Molecular Properties
| Compound Name | [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate |
| PubChem CID | 17162315 |
| Molecular Formula | C24H21BrO5 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate |
| SMILES | CCOc1ccc(Br)cc1C(=O)Oc1cccc(C(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H21BrO5/c1-2-28-22-12-11-19(25)16-21(22)24(27)30-20-10-6-9-18(15-20)23(26)29-14-13-17-7-4-3-5-8-17/h3-12,15-16H,2,13-14H2,1H3 |
| InChIKey | FBVLVNLMSBEEAY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate?
The IUPAC name of [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate (CID 17162315) is [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate.
What is the SMILES notation for [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate?
The canonical SMILES for [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate is CCOc1ccc(Br)cc1C(=O)Oc1cccc(C(=O)OCCc2ccccc2)c1.
What is the InChIKey of [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate?
The InChIKey is FBVLVNLMSBEEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21BrO5/c1-2-28-22-12-11-19(25)16-21(22)24(27)30-20-10-6-9-18(15-20)23(26)29-14-13-17-7-4-3-5-8-17/h3-12,15-16H,2,13-14H2,1H3.
What are the key properties of [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate?
[3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate has a molecular weight of 469.33 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-phenylethoxycarbonyl)phenyl] 5-bromo-2-ethoxybenzoate is sourced from PubChem (CID 17162315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).