C18H19BrO3 — CID 23012843
3-phenylpropyl 5-bromo-2-ethoxybenzoate (PubChem CID 23012843) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is 3-phenylpropyl 5-bromo-2-ethoxybenzoate.
| Compound Name | 3-phenylpropyl 5-bromo-2-ethoxybenzoate |
|---|---|
| PubChem CID | 23012843 |
| Molecular Formula | C18H19BrO3 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-phenylpropyl 5-bromo-2-ethoxybenzoate |
| SMILES | CCOc1ccc(Br)cc1C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C18H19BrO3/c1-2-21-17-11-10-15(19)13-16(17)18(20)22-12-6-9-14-7-4-3-5-8-14/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3 |
| InChIKey | PYAZMTIXQFYUST-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|