C26H25BrO5 — CID 17138040
[4-(3-phenylpropoxycarbonyl)phenyl] 5-bromo-2-propan-2-yloxybenzoate (PubChem CID 17138040) has the molecular formula C26H25BrO5 and a molecular weight of 497.39 g/mol. Its IUPAC name is [4-(3-phenylpropoxycarbonyl)phenyl] 5-bromo-2-propan-2-yloxybenzoate.
| Compound Name | [4-(3-phenylpropoxycarbonyl)phenyl] 5-bromo-2-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 17138040 |
| Molecular Formula | C26H25BrO5 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [4-(3-phenylpropoxycarbonyl)phenyl] 5-bromo-2-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(Br)cc1C(=O)Oc1ccc(C(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H25BrO5/c1-18(2)31-24-15-12-21(27)17-23(24)26(29)32-22-13-10-20(11-14-22)25(28)30-16-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-15,17-18H,6,9,16H2,1-2H3 |
| InChIKey | RNAPJNOXUAFPLW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|