C25H33N3O3 — CID 171623786
methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-methylpiperidin-3-yl)amino]benzoate (PubChem CID 171623786) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-methylpiperidin-3-yl)amino]benzoate.
| Compound Name | methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-methylpiperidin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 171623786 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-methylpiperidin-3-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)cc1NC1CCCN(C)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-25(2,3)18-10-8-17(9-11-18)23(29)27-19-12-13-21(24(30)31-5)22(15-19)26-20-7-6-14-28(4)16-20/h8-13,15,20,26H,6-7,14,16H2,1-5H3,(H,27,29) |
| InChIKey | DLJHOHSMWPFIDJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |