C27H35N3O4 — CID 171623747
methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-propanoylpiperidin-3-yl)amino]benzoate (PubChem CID 171623747) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-propanoylpiperidin-3-yl)amino]benzoate.
| Compound Name | methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-propanoylpiperidin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 171623747 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | methyl 4-[(4-tert-butylbenzoyl)amino]-2-[(1-propanoylpiperidin-3-yl)amino]benzoate |
| SMILES | CCC(=O)N1CCCC(Nc2cc(NC(=O)c3ccc(C(C)(C)C)cc3)ccc2C(=O)OC)C1 |
| InChI | InChI=1S/C27H35N3O4/c1-6-24(31)30-15-7-8-21(17-30)28-23-16-20(13-14-22(23)26(33)34-5)29-25(32)18-9-11-19(12-10-18)27(2,3)4/h9-14,16,21,28H,6-8,15,17H2,1-5H3,(H,29,32) |
| InChIKey | RCKHYEJZQXKTBC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |