C29H42N6O3 — CID 171624569
N'-[(Z)-2-[amino-[[(2R)-4-ethoxy-4-methylpentan-2-yl]-[6-(4-methyl-2-oxo-1,3-oxazolidin-3-yl)-2-pyridinyl]amino]methyl]but-1-enyl]-N-phenylmethanimidamide (PubChem CID 171624569) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is N'-[(Z)-2-[amino-[[(2R)-4-ethoxy-4-methylpentan-2-yl]-[6-(4-methyl-2-oxo-1,3-oxazolidin-3-yl)-2-pyridinyl]amino]methyl]but-1-enyl]-N-phenylmethanimidamide.
| Compound Name | N'-[(Z)-2-[amino-[[(2R)-4-ethoxy-4-methylpentan-2-yl]-[6-(4-methyl-2-oxo-1,3-oxazolidin-3-yl)-2-pyridinyl]amino]methyl]but-1-enyl]-N-phenylmethanimidamide |
|---|---|
| PubChem CID | 171624569 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | N'-[(Z)-2-[amino-[[(2R)-4-ethoxy-4-methylpentan-2-yl]-[6-(4-methyl-2-oxo-1,3-oxazolidin-3-yl)-2-pyridinyl]amino]methyl]but-1-enyl]-N-phenylmethanimidamide |
| SMILES | CCOC(C)(C)C[C@@H](C)N(c1cccc(N2C(=O)OCC2C)n1)C(N)/C(=C\N=C\Nc1ccccc1)CC |
| InChI | InChI=1S/C29H42N6O3/c1-7-23(18-31-20-32-24-13-10-9-11-14-24)27(30)34(21(3)17-29(5,6)38-8-2)25-15-12-16-26(33-25)35-22(4)19-37-28(35)36/h9-16,18,20-22,27H,7-8,17,19,30H2,1-6H3,(H,31,32)/b23-18-/t21-,22?,27?/m1/s1 |
| InChIKey | WTVCENBEZMBEFX-CIGFYBSTSA-N |
| XLogP | 5.55 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|