C14H22BrN3 — CID 171626210
2-(4-bromophenyl)-4,5-dimethyltriazole;ethane (PubChem CID 171626210) has the molecular formula C14H22BrN3 and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,5-dimethyltriazole;ethane.
| Compound Name | 2-(4-bromophenyl)-4,5-dimethyltriazole;ethane |
|---|---|
| PubChem CID | 171626210 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(4-bromophenyl)-4,5-dimethyltriazole;ethane |
| SMILES | CC.CC.Cc1nn(-c2ccc(Br)cc2)nc1C |
| InChI | InChI=1S/C10H10BrN3.2C2H6/c1-7-8(2)13-14(12-7)10-5-3-9(11)4-6-10;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | UHPBSNQYYHNWKU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |