C8H17N3 — CID 171626353
(Z)-2-(N-ethyl-C-methylcarbonimidoyl)but-2-ene-1,3-diamine (PubChem CID 171626353) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-2-(N-ethyl-C-methylcarbonimidoyl)but-2-ene-1,3-diamine.
| Compound Name | (Z)-2-(N-ethyl-C-methylcarbonimidoyl)but-2-ene-1,3-diamine |
|---|---|
| PubChem CID | 171626353 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (Z)-2-(N-ethyl-C-methylcarbonimidoyl)but-2-ene-1,3-diamine |
| SMILES | CC/N=C(C)/C(CN)=C(/C)N |
| InChI | InChI=1S/C8H17N3/c1-4-11-7(3)8(5-9)6(2)10/h4-5,9-10H2,1-3H3/b8-6-,11-7+ |
| InChIKey | UEADJLZSOUUJTE-FAWHLJIPSA-N |
| XLogP | 0.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|