C7H15N3 — CID 171626438
(Z)-3-(methyliminomethyl)pent-2-ene-2,4-diamine (PubChem CID 171626438) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (Z)-3-(methyliminomethyl)pent-2-ene-2,4-diamine.
| Compound Name | (Z)-3-(methyliminomethyl)pent-2-ene-2,4-diamine |
|---|---|
| PubChem CID | 171626438 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (Z)-3-(methyliminomethyl)pent-2-ene-2,4-diamine |
| SMILES | C/N=C/C(=C(/C)N)C(C)N |
| InChI | InChI=1S/C7H15N3/c1-5(8)7(4-10-3)6(2)9/h4-5H,8-9H2,1-3H3/b7-6+,10-4+ |
| InChIKey | SERWYUIOFIZMJB-PKOYOFPESA-N |
| XLogP | 0.27 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|