C7H13N2+ — CID 18723566
1,2,3-trimethyl-2H-pyrrol-1-ium-4-amine (PubChem CID 18723566) has the molecular formula C7H13N2+ and a molecular weight of 125.19 g/mol. Its IUPAC name is 1,2,3-trimethyl-2H-pyrrol-1-ium-4-amine.
| Compound Name | 1,2,3-trimethyl-2H-pyrrol-1-ium-4-amine |
|---|---|
| PubChem CID | 18723566 |
| Molecular Formula | C7H13N2+ |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 1,2,3-trimethyl-2H-pyrrol-1-ium-4-amine |
| SMILES | CC1=C(N)C=[N+](C)C1C |
| InChI | InChI=1S/C7H13N2/c1-5-6(2)9(3)4-7(5)8/h4,6H,8H2,1-3H3/q+1 |
| InChIKey | CYYDRWCYUSRTAK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|