C11H10ClN5O2 — CID 17162681
5-chloro-N-(2-ethenyltetrazol-5-yl)-2-methoxybenzamide (PubChem CID 17162681) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is 5-chloro-N-(2-ethenyltetrazol-5-yl)-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(2-ethenyltetrazol-5-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 17162681 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-chloro-N-(2-ethenyltetrazol-5-yl)-2-methoxybenzamide |
| SMILES | C=Cn1nnc(NC(=O)c2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C11H10ClN5O2/c1-3-17-15-11(14-16-17)13-10(18)8-6-7(12)4-5-9(8)19-2/h3-6H,1H2,2H3,(H,13,15,18) |
| InChIKey | GCVLNGDSTBIGHE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |