C10H7Cl2N5O — CID 17162644
3,4-dichloro-N-(2-ethenyltetrazol-5-yl)benzamide (PubChem CID 17162644) has the molecular formula C10H7Cl2N5O and a molecular weight of 284.11 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-ethenyltetrazol-5-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-ethenyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 17162644 |
| Molecular Formula | C10H7Cl2N5O |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3,4-dichloro-N-(2-ethenyltetrazol-5-yl)benzamide |
| SMILES | C=Cn1nnc(NC(=O)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H7Cl2N5O/c1-2-17-15-10(14-16-17)13-9(18)6-3-4-7(11)8(12)5-6/h2-5H,1H2,(H,13,15,18) |
| InChIKey | KFCNZXFJSTXUOG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |