C5H7N5O — CID 17162682
N-(2-ethenyltetrazol-5-yl)acetamide (PubChem CID 17162682) has the molecular formula C5H7N5O and a molecular weight of 153.14 g/mol. Its IUPAC name is N-(2-ethenyltetrazol-5-yl)acetamide.
| Compound Name | N-(2-ethenyltetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 17162682 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | N-(2-ethenyltetrazol-5-yl)acetamide |
| SMILES | C=Cn1nnc(NC(C)=O)n1 |
| InChI | InChI=1S/C5H7N5O/c1-3-10-8-5(7-9-10)6-4(2)11/h3H,1H2,2H3,(H,6,8,11) |
| InChIKey | HLYGFPBVZHJCMM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |