C23H30ClN7O2 — CID 171627358
N-butyl-1-[5-chloro-2-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]amino]pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 171627358) has the molecular formula C23H30ClN7O2 and a molecular weight of 471.99 g/mol. Its IUPAC name is N-butyl-1-[5-chloro-2-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]amino]pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[5-chloro-2-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]amino]pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171627358 |
| Molecular Formula | C23H30ClN7O2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-butyl-1-[5-chloro-2-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]amino]pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2nc(Nc3cncc(N4CCCC4=O)c3)ncc2Cl)C1 |
| InChI | InChI=1S/C23H30ClN7O2/c1-2-3-8-26-22(33)16-6-4-9-30(15-16)21-19(24)14-27-23(29-21)28-17-11-18(13-25-12-17)31-10-5-7-20(31)32/h11-14,16H,2-10,15H2,1H3,(H,26,33)(H,27,28,29) |
| InChIKey | CGPSAYWWLPPIMH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|