C25H26ClN5O — CID 171627428
1-[2-[[5-chloro-4-(3-cyclohexylphenyl)pyrimidin-2-yl]amino]-4-pyridinyl]pyrrolidin-2-one (PubChem CID 171627428) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is 1-[2-[[5-chloro-4-(3-cyclohexylphenyl)pyrimidin-2-yl]amino]-4-pyridinyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[5-chloro-4-(3-cyclohexylphenyl)pyrimidin-2-yl]amino]-4-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171627428 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[2-[[5-chloro-4-(3-cyclohexylphenyl)pyrimidin-2-yl]amino]-4-pyridinyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccnc(Nc2ncc(Cl)c(-c3cccc(C4CCCCC4)c3)n2)c1 |
| InChI | InChI=1S/C25H26ClN5O/c26-21-16-28-25(29-22-15-20(11-12-27-22)31-13-5-10-23(31)32)30-24(21)19-9-4-8-18(14-19)17-6-2-1-3-7-17/h4,8-9,11-12,14-17H,1-3,5-7,10,13H2,(H,27,28,29,30) |
| InChIKey | SHSMRFAFUFJLQA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |