C22H24ClN7NbO-2 — CID 171626913
1-[5-[[5-chloro-4-(1-pentan-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one;methylideneniobium (PubChem CID 171626913) has the molecular formula C22H24ClN7NbO-2 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1-[5-[[5-chloro-4-(1-pentan-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one;methylideneniobium.
| Compound Name | 1-[5-[[5-chloro-4-(1-pentan-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one;methylideneniobium |
|---|---|
| PubChem CID | 171626913 |
| Molecular Formula | C22H24ClN7NbO-2 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 1-[5-[[5-chloro-4-(1-pentan-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one;methylideneniobium |
| SMILES | C=[Nb].[CH2-]CC(C[CH2-])n1cc(-c2nc(Nc3cncc(N4CCCC4=O)c3)ncc2Cl)cn1 |
| InChI | InChI=1S/C21H22ClN7O.CH2.Nb/c1-3-16(4-2)29-13-14(9-25-29)20-18(22)12-24-21(27-20)26-15-8-17(11-23-10-15)28-7-5-6-19(28)30;;/h8-13,16H,1-7H2,(H,24,26,27);1H2;/q-2;; |
| InChIKey | CTSRRRMIUBYZIP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|