C30H33BrO — CID 171628489
(4S)-4-(3-bromonaphthalen-1-yl)-1-[2-methyl-5-(2-methylidenehept-6-enyl)phenyl]pentan-1-one (PubChem CID 171628489) has the molecular formula C30H33BrO and a molecular weight of 489.50 g/mol. Its IUPAC name is (4S)-4-(3-bromonaphthalen-1-yl)-1-[2-methyl-5-(2-methylidenehept-6-enyl)phenyl]pentan-1-one.
| Compound Name | (4S)-4-(3-bromonaphthalen-1-yl)-1-[2-methyl-5-(2-methylidenehept-6-enyl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 171628489 |
| Molecular Formula | C30H33BrO |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (4S)-4-(3-bromonaphthalen-1-yl)-1-[2-methyl-5-(2-methylidenehept-6-enyl)phenyl]pentan-1-one |
| SMILES | C=CCCCC(=C)Cc1ccc(C)c(C(=O)CC[C@H](C)c2cc(Br)cc3ccccc23)c1 |
| InChI | InChI=1S/C30H33BrO/c1-5-6-7-10-21(2)17-24-15-13-23(4)29(18-24)30(32)16-14-22(3)28-20-26(31)19-25-11-8-9-12-27(25)28/h5,8-9,11-13,15,18-20,22H,1-2,6-7,10,14,16-17H2,3-4H3/t22-/m0/s1 |
| InChIKey | JTOBCRIULROAKC-QFIPXVFZSA-N |
| XLogP | 9.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|