C31H40N2O2 — CID 171628493
5-ethyl-2-methyl-N-[1-[3-[(E)-1-(4-oxopentylamino)prop-1-en-2-yl]naphthalen-1-yl]ethyl]benzamide;methane (PubChem CID 171628493) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is 5-ethyl-2-methyl-N-[1-[3-[(E)-1-(4-oxopentylamino)prop-1-en-2-yl]naphthalen-1-yl]ethyl]benzamide;methane.
| Compound Name | 5-ethyl-2-methyl-N-[1-[3-[(E)-1-(4-oxopentylamino)prop-1-en-2-yl]naphthalen-1-yl]ethyl]benzamide;methane |
|---|---|
| PubChem CID | 171628493 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 5-ethyl-2-methyl-N-[1-[3-[(E)-1-(4-oxopentylamino)prop-1-en-2-yl]naphthalen-1-yl]ethyl]benzamide;methane |
| SMILES | C.CCc1ccc(C)c(C(=O)NC(C)c2cc(/C(C)=C/NCCCC(C)=O)cc3ccccc23)c1 |
| InChI | InChI=1S/C30H36N2O2.CH4/c1-6-24-14-13-20(2)28(16-24)30(34)32-23(5)29-18-26(17-25-11-7-8-12-27(25)29)21(3)19-31-15-9-10-22(4)33;/h7-8,11-14,16-19,23,31H,6,9-10,15H2,1-5H3,(H,32,34);1H4/b21-19+; |
| InChIKey | QLDWYOMGIZZSOX-UXJRWBAGSA-N |
| XLogP | 7.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|