C28H34N2O — CID 178174489
5-[hept-1-en-4-yl(methyl)amino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 178174489) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 5-[hept-1-en-4-yl(methyl)amino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 5-[hept-1-en-4-yl(methyl)amino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 178174489 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 5-[hept-1-en-4-yl(methyl)amino]-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | C=CCC(CCC)N(C)c1ccc(C)c(C(=O)N[C@H](C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C28H34N2O/c1-6-11-23(12-7-2)30(5)24-18-17-20(3)27(19-24)28(31)29-21(4)25-16-10-14-22-13-8-9-15-26(22)25/h6,8-10,13-19,21,23H,1,7,11-12H2,2-5H3,(H,29,31)/t21-,23?/m1/s1 |
| InChIKey | CTNBMPMKEYHGOQ-FKHAVUOCSA-N |
| XLogP | 6.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|