C27H32N2O — CID 178174404
2-methyl-5-[methyl-(3-methylidenecyclopentyl)amino]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide;molecular hydrogen (PubChem CID 178174404) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-methyl-5-[methyl-(3-methylidenecyclopentyl)amino]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide;molecular hydrogen.
| Compound Name | 2-methyl-5-[methyl-(3-methylidenecyclopentyl)amino]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 178174404 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-methyl-5-[methyl-(3-methylidenecyclopentyl)amino]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide;molecular hydrogen |
| SMILES | C=C1CCC(N(C)c2ccc(C)c(C(=O)N[C@H](C)c3cccc4ccccc34)c2)C1.[H][H] |
| InChI | InChI=1S/C27H30N2O.H2/c1-18-12-14-22(16-18)29(4)23-15-13-19(2)26(17-23)27(30)28-20(3)24-11-7-9-21-8-5-6-10-25(21)24;/h5-11,13,15,17,20,22H,1,12,14,16H2,2-4H3,(H,28,30);1H/t20-,22?;/m1./s1 |
| InChIKey | MGJQTWZDBDUKSC-DWUQZJAVSA-N |
| XLogP | 6.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|